About 1-ethylnaphthalene;1-phenylnaphthalene
1-ethylnaphthalene;1-phenylnaphthalene (PubChem CID 173023243) has the molecular formula C28H24
and a molecular weight of 360.50 g/mol. Its IUPAC name is 1-ethylnaphthalene;1-phenylnaphthalene.
Molecular Properties
| Compound Name | 1-ethylnaphthalene;1-phenylnaphthalene |
| PubChem CID | 173023243 |
| Molecular Formula | C28H24 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | 1-ethylnaphthalene;1-phenylnaphthalene |
| SMILES | CCc1cccc2ccccc12.c1ccc(-c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C16H12.C12H12/c1-2-7-13(8-3-1)16-12-6-10-14-9-4-5-11-15(14)16;1-2-10-7-5-8-11-6-3-4-9-12(10)11/h1-12H;3-9H,2H2,1H3 |
| InChIKey | VTXUHFZQLWTWAJ-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-ethylnaphthalene;1-phenylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylnaphthalene;1-phenylnaphthalene?
The IUPAC name of 1-ethylnaphthalene;1-phenylnaphthalene (CID 173023243) is 1-ethylnaphthalene;1-phenylnaphthalene.
What is the SMILES notation for 1-ethylnaphthalene;1-phenylnaphthalene?
The canonical SMILES for 1-ethylnaphthalene;1-phenylnaphthalene is CCc1cccc2ccccc12.c1ccc(-c2cccc3ccccc23)cc1.
What is the InChIKey of 1-ethylnaphthalene;1-phenylnaphthalene?
The InChIKey is VTXUHFZQLWTWAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12.C12H12/c1-2-7-13(8-3-1)16-12-6-10-14-9-4-5-11-15(14)16;1-2-10-7-5-8-11-6-3-4-9-12(10)11/h1-12H;3-9H,2H2,1H3.
What are the key properties of 1-ethylnaphthalene;1-phenylnaphthalene?
1-ethylnaphthalene;1-phenylnaphthalene has a molecular weight of 360.50 g/mol, XLogP of 7.91, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylnaphthalene;1-phenylnaphthalene is sourced from PubChem (CID 173023243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).