About sodium;1-ethylnaphthalene;phenoxide
sodium;1-ethylnaphthalene;phenoxide (PubChem CID 159168482) has the molecular formula C18H17NaO
and a molecular weight of 272.32 g/mol. Its IUPAC name is sodium;1-ethylnaphthalene;phenoxide.
Molecular Properties
| Compound Name | sodium;1-ethylnaphthalene;phenoxide |
| PubChem CID | 159168482 |
| Molecular Formula | C18H17NaO |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | sodium;1-ethylnaphthalene;phenoxide |
| SMILES | CCc1cccc2ccccc12.[Na+].[O-]c1ccccc1 |
| InChI | InChI=1S/C12H12.C6H6O.Na/c1-2-10-7-5-8-11-6-3-4-9-12(10)11;7-6-4-2-1-3-5-6;/h3-9H,2H2,1H3;1-5,7H;/q;;+1/p-1 |
| InChIKey | KLJMDKSOCOSNBH-UHFFFAOYSA-M |
| XLogP | 1.17 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze sodium;1-ethylnaphthalene;phenoxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;1-ethylnaphthalene;phenoxide?
The IUPAC name of sodium;1-ethylnaphthalene;phenoxide (CID 159168482) is sodium;1-ethylnaphthalene;phenoxide.
What is the SMILES notation for sodium;1-ethylnaphthalene;phenoxide?
The canonical SMILES for sodium;1-ethylnaphthalene;phenoxide is CCc1cccc2ccccc12.[Na+].[O-]c1ccccc1.
What is the InChIKey of sodium;1-ethylnaphthalene;phenoxide?
The InChIKey is KLJMDKSOCOSNBH-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H12.C6H6O.Na/c1-2-10-7-5-8-11-6-3-4-9-12(10)11;7-6-4-2-1-3-5-6;/h3-9H,2H2,1H3;1-5,7H;/q;;+1/p-1.
What are the key properties of sodium;1-ethylnaphthalene;phenoxide?
sodium;1-ethylnaphthalene;phenoxide has a molecular weight of 272.32 g/mol, XLogP of 1.17, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;1-ethylnaphthalene;phenoxide is sourced from PubChem (CID 159168482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).