About 1-ethylnaphthalene;prop-2-ene-1-sulfonyl chloride
1-ethylnaphthalene;prop-2-ene-1-sulfonyl chloride (PubChem CID 174651228) has the molecular formula C15H17ClO2S
and a molecular weight of 296.82 g/mol. Its IUPAC name is 1-ethylnaphthalene;prop-2-ene-1-sulfonyl chloride.
Molecular Properties
| Compound Name | 1-ethylnaphthalene;prop-2-ene-1-sulfonyl chloride |
| PubChem CID | 174651228 |
| Molecular Formula | C15H17ClO2S |
| Molecular Weight | 296.82 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 1-ethylnaphthalene;prop-2-ene-1-sulfonyl chloride |
| SMILES | C=CCS(=O)(=O)Cl.CCc1cccc2ccccc12 |
| InChI | InChI=1S/C12H12.C3H5ClO2S/c1-2-10-7-5-8-11-6-3-4-9-12(10)11;1-2-3-7(4,5)6/h3-9H,2H2,1H3;2H,1,3H2 |
| InChIKey | CWYWAURPAJRPDY-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.82 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-ethylnaphthalene;prop-2-ene-1-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylnaphthalene;prop-2-ene-1-sulfonyl chloride?
The IUPAC name of 1-ethylnaphthalene;prop-2-ene-1-sulfonyl chloride (CID 174651228) is 1-ethylnaphthalene;prop-2-ene-1-sulfonyl chloride.
What is the SMILES notation for 1-ethylnaphthalene;prop-2-ene-1-sulfonyl chloride?
The canonical SMILES for 1-ethylnaphthalene;prop-2-ene-1-sulfonyl chloride is C=CCS(=O)(=O)Cl.CCc1cccc2ccccc12.
What is the InChIKey of 1-ethylnaphthalene;prop-2-ene-1-sulfonyl chloride?
The InChIKey is CWYWAURPAJRPDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12.C3H5ClO2S/c1-2-10-7-5-8-11-6-3-4-9-12(10)11;1-2-3-7(4,5)6/h3-9H,2H2,1H3;2H,1,3H2.
What are the key properties of 1-ethylnaphthalene;prop-2-ene-1-sulfonyl chloride?
1-ethylnaphthalene;prop-2-ene-1-sulfonyl chloride has a molecular weight of 296.82 g/mol, XLogP of 4.14, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylnaphthalene;prop-2-ene-1-sulfonyl chloride is sourced from PubChem (CID 174651228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).