1-ethylnaphthalene;prop-2-ene-1-sulfonyl chloride

C15H17ClO2S — CID 174651228

IUPAC1-ethylnaphthalene;prop-2-ene-1-sulfonyl chloride
SMILESC=CCS(=O)(=O)Cl.CCc1cccc2ccccc12
InChIInChI=1S/C12H12.C3H5ClO2S/c1-2-10-7-5-8-11-6-3-4-9-12(10)11;1-2-3-7(4,5)6/h3-9H,2H2,1H3;2H,1,3H2
InChIKeyCWYWAURPAJRPDY-UHFFFAOYSA-N
MW296.82 g/mol
LogP4.14
Rot. Bonds3

About 1-ethylnaphthalene;prop-2-ene-1-sulfonyl chloride

1-ethylnaphthalene;prop-2-ene-1-sulfonyl chloride (PubChem CID 174651228) has the molecular formula C15H17ClO2S and a molecular weight of 296.82 g/mol. Its IUPAC name is 1-ethylnaphthalene;prop-2-ene-1-sulfonyl chloride.

Molecular Properties

Compound Name1-ethylnaphthalene;prop-2-ene-1-sulfonyl chloride
PubChem CID174651228
Molecular FormulaC15H17ClO2S
Molecular Weight296.82 g/mol
Exact Mass296.06
IUPAC Name1-ethylnaphthalene;prop-2-ene-1-sulfonyl chloride
SMILESC=CCS(=O)(=O)Cl.CCc1cccc2ccccc12
InChIInChI=1S/C12H12.C3H5ClO2S/c1-2-10-7-5-8-11-6-3-4-9-12(10)11;1-2-3-7(4,5)6/h3-9H,2H2,1H3;2H,1,3H2
InChIKeyCWYWAURPAJRPDY-UHFFFAOYSA-N
XLogP4.14
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500296.82
LogP ≤ 54.14
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 1-ethylnaphthalene;prop-2-ene-1-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-ethylnaphthalene;prop-2-ene-1-sulfonyl chloride?
The IUPAC name of 1-ethylnaphthalene;prop-2-ene-1-sulfonyl chloride (CID 174651228) is 1-ethylnaphthalene;prop-2-ene-1-sulfonyl chloride.
What is the SMILES notation for 1-ethylnaphthalene;prop-2-ene-1-sulfonyl chloride?
The canonical SMILES for 1-ethylnaphthalene;prop-2-ene-1-sulfonyl chloride is C=CCS(=O)(=O)Cl.CCc1cccc2ccccc12.
What is the InChIKey of 1-ethylnaphthalene;prop-2-ene-1-sulfonyl chloride?
The InChIKey is CWYWAURPAJRPDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12.C3H5ClO2S/c1-2-10-7-5-8-11-6-3-4-9-12(10)11;1-2-3-7(4,5)6/h3-9H,2H2,1H3;2H,1,3H2.
What are the key properties of 1-ethylnaphthalene;prop-2-ene-1-sulfonyl chloride?
1-ethylnaphthalene;prop-2-ene-1-sulfonyl chloride has a molecular weight of 296.82 g/mol, XLogP of 4.14, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylnaphthalene;prop-2-ene-1-sulfonyl chloride is sourced from PubChem (CID 174651228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).