About formaldehyde;1-prop-2-enylnaphthalene;sulfuric acid
formaldehyde;1-prop-2-enylnaphthalene;sulfuric acid (PubChem CID 70221186) has the molecular formula C14H16O5S
and a molecular weight of 296.34 g/mol. Its IUPAC name is formaldehyde;1-prop-2-enylnaphthalene;sulfuric acid.
Molecular Properties
| Compound Name | formaldehyde;1-prop-2-enylnaphthalene;sulfuric acid |
| PubChem CID | 70221186 |
| Molecular Formula | C14H16O5S |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | formaldehyde;1-prop-2-enylnaphthalene;sulfuric acid |
| SMILES | C=CCc1cccc2ccccc12.C=O.O=S(=O)(O)O |
| InChI | InChI=1S/C13H12.CH2O.H2O4S/c1-2-6-11-8-5-9-12-7-3-4-10-13(11)12;1-2;1-5(2,3)4/h2-5,7-10H,1,6H2;1H2;(H2,1,2,3,4) |
| InChIKey | LPKHRCSPLKVJIE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze formaldehyde;1-prop-2-enylnaphthalene;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;1-prop-2-enylnaphthalene;sulfuric acid?
The IUPAC name of formaldehyde;1-prop-2-enylnaphthalene;sulfuric acid (CID 70221186) is formaldehyde;1-prop-2-enylnaphthalene;sulfuric acid.
What is the SMILES notation for formaldehyde;1-prop-2-enylnaphthalene;sulfuric acid?
The canonical SMILES for formaldehyde;1-prop-2-enylnaphthalene;sulfuric acid is C=CCc1cccc2ccccc12.C=O.O=S(=O)(O)O.
What is the InChIKey of formaldehyde;1-prop-2-enylnaphthalene;sulfuric acid?
The InChIKey is LPKHRCSPLKVJIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12.CH2O.H2O4S/c1-2-6-11-8-5-9-12-7-3-4-10-13(11)12;1-2;1-5(2,3)4/h2-5,7-10H,1,6H2;1H2;(H2,1,2,3,4).
What are the key properties of formaldehyde;1-prop-2-enylnaphthalene;sulfuric acid?
formaldehyde;1-prop-2-enylnaphthalene;sulfuric acid has a molecular weight of 296.34 g/mol, XLogP of 2.73, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;1-prop-2-enylnaphthalene;sulfuric acid is sourced from PubChem (CID 70221186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).