About 2-prop-2-enylphenol;sulfuryl dichloride
2-prop-2-enylphenol;sulfuryl dichloride (PubChem CID 174775131) has the molecular formula C9H10Cl2O3S
and a molecular weight of 269.15 g/mol. Its IUPAC name is 2-prop-2-enylphenol;sulfuryl dichloride.
Molecular Properties
| Compound Name | 2-prop-2-enylphenol;sulfuryl dichloride |
| PubChem CID | 174775131 |
| Molecular Formula | C9H10Cl2O3S |
| Molecular Weight | 269.15 g/mol |
| Exact Mass | 267.97 |
| IUPAC Name | 2-prop-2-enylphenol;sulfuryl dichloride |
| SMILES | C=CCc1ccccc1O.O=S(=O)(Cl)Cl |
| InChI | InChI=1S/C9H10O.Cl2O2S/c1-2-5-8-6-3-4-7-9(8)10;1-5(2,3)4/h2-4,6-7,10H,1,5H2; |
| InChIKey | HONAKQNQQZXTKD-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.15 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-2-enylphenol;sulfuryl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-2-enylphenol;sulfuryl dichloride?
The IUPAC name of 2-prop-2-enylphenol;sulfuryl dichloride (CID 174775131) is 2-prop-2-enylphenol;sulfuryl dichloride.
What is the SMILES notation for 2-prop-2-enylphenol;sulfuryl dichloride?
The canonical SMILES for 2-prop-2-enylphenol;sulfuryl dichloride is C=CCc1ccccc1O.O=S(=O)(Cl)Cl.
What is the InChIKey of 2-prop-2-enylphenol;sulfuryl dichloride?
The InChIKey is HONAKQNQQZXTKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O.Cl2O2S/c1-2-5-8-6-3-4-7-9(8)10;1-5(2,3)4/h2-4,6-7,10H,1,5H2;.
What are the key properties of 2-prop-2-enylphenol;sulfuryl dichloride?
2-prop-2-enylphenol;sulfuryl dichloride has a molecular weight of 269.15 g/mol, XLogP of 2.83, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-enylphenol;sulfuryl dichloride is sourced from PubChem (CID 174775131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).