About boric acid;2-prop-2-enylphenol
boric acid;2-prop-2-enylphenol (PubChem CID 70457137) has the molecular formula C9H13BO4
and a molecular weight of 196.01 g/mol. Its IUPAC name is boric acid;2-prop-2-enylphenol.
Molecular Properties
| Compound Name | boric acid;2-prop-2-enylphenol |
| PubChem CID | 70457137 |
| Molecular Formula | C9H13BO4 |
| Molecular Weight | 196.01 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | boric acid;2-prop-2-enylphenol |
| SMILES | C=CCc1ccccc1O.OB(O)O |
| InChI | InChI=1S/C9H10O.BH3O3/c1-2-5-8-6-3-4-7-9(8)10;2-1(3)4/h2-4,6-7,10H,1,5H2;2-4H |
| InChIKey | WZTGGPWUMOBKCZ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.01 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze boric acid;2-prop-2-enylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of boric acid;2-prop-2-enylphenol?
The IUPAC name of boric acid;2-prop-2-enylphenol (CID 70457137) is boric acid;2-prop-2-enylphenol.
What is the SMILES notation for boric acid;2-prop-2-enylphenol?
The canonical SMILES for boric acid;2-prop-2-enylphenol is C=CCc1ccccc1O.OB(O)O.
What is the InChIKey of boric acid;2-prop-2-enylphenol?
The InChIKey is WZTGGPWUMOBKCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O.BH3O3/c1-2-5-8-6-3-4-7-9(8)10;2-1(3)4/h2-4,6-7,10H,1,5H2;2-4H.
What are the key properties of boric acid;2-prop-2-enylphenol?
boric acid;2-prop-2-enylphenol has a molecular weight of 196.01 g/mol, XLogP of 0.07, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for boric acid;2-prop-2-enylphenol is sourced from PubChem (CID 70457137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).