C13H16O2 — CID 174684610
1,2-bis(prop-2-enyl)benzene;formic acid (PubChem CID 174684610) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 1,2-bis(prop-2-enyl)benzene;formic acid.
| Compound Name | 1,2-bis(prop-2-enyl)benzene;formic acid |
|---|---|
| PubChem CID | 174684610 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 1,2-bis(prop-2-enyl)benzene;formic acid |
| SMILES | C=CCc1ccccc1CC=C.O=CO |
| InChI | InChI=1S/C12H14.CH2O2/c1-3-7-11-9-5-6-10-12(11)8-4-2;2-1-3/h3-6,9-10H,1-2,7-8H2;1H,(H,2,3) |
| InChIKey | FNHGGUSVPZNPLZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|