About (2-prop-2-enylphenyl) 2-oxoacetate
(2-prop-2-enylphenyl) 2-oxoacetate (PubChem CID 87234163) has the molecular formula C11H10O3
and a molecular weight of 190.20 g/mol. Its IUPAC name is (2-prop-2-enylphenyl) 2-oxoacetate.
Molecular Properties
| Compound Name | (2-prop-2-enylphenyl) 2-oxoacetate |
| PubChem CID | 87234163 |
| Molecular Formula | C11H10O3 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | (2-prop-2-enylphenyl) 2-oxoacetate |
| SMILES | C=CCc1ccccc1OC(=O)C=O |
| InChI | InChI=1S/C11H10O3/c1-2-5-9-6-3-4-7-10(9)14-11(13)8-12/h2-4,6-8H,1,5H2 |
| InChIKey | HIOCTYXFYUXGCY-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-prop-2-enylphenyl) 2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-prop-2-enylphenyl) 2-oxoacetate?
The IUPAC name of (2-prop-2-enylphenyl) 2-oxoacetate (CID 87234163) is (2-prop-2-enylphenyl) 2-oxoacetate.
What is the SMILES notation for (2-prop-2-enylphenyl) 2-oxoacetate?
The canonical SMILES for (2-prop-2-enylphenyl) 2-oxoacetate is C=CCc1ccccc1OC(=O)C=O.
What is the InChIKey of (2-prop-2-enylphenyl) 2-oxoacetate?
The InChIKey is HIOCTYXFYUXGCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O3/c1-2-5-9-6-3-4-7-10(9)14-11(13)8-12/h2-4,6-8H,1,5H2.
What are the key properties of (2-prop-2-enylphenyl) 2-oxoacetate?
(2-prop-2-enylphenyl) 2-oxoacetate has a molecular weight of 190.20 g/mol, XLogP of 1.52, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-prop-2-enylphenyl) 2-oxoacetate is sourced from PubChem (CID 87234163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).