About (2-prop-2-enoylphenyl) 2-oxoacetate
(2-prop-2-enoylphenyl) 2-oxoacetate (PubChem CID 87741605) has the molecular formula C11H8O4
and a molecular weight of 204.18 g/mol. Its IUPAC name is (2-prop-2-enoylphenyl) 2-oxoacetate.
Molecular Properties
| Compound Name | (2-prop-2-enoylphenyl) 2-oxoacetate |
| PubChem CID | 87741605 |
| Molecular Formula | C11H8O4 |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.04 |
| IUPAC Name | (2-prop-2-enoylphenyl) 2-oxoacetate |
| SMILES | C=CC(=O)c1ccccc1OC(=O)C=O |
| InChI | InChI=1S/C11H8O4/c1-2-9(13)8-5-3-4-6-10(8)15-11(14)7-12/h2-7H,1H2 |
| InChIKey | XMDHVGWNVHEWSQ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-prop-2-enoylphenyl) 2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-prop-2-enoylphenyl) 2-oxoacetate?
The IUPAC name of (2-prop-2-enoylphenyl) 2-oxoacetate (CID 87741605) is (2-prop-2-enoylphenyl) 2-oxoacetate.
What is the SMILES notation for (2-prop-2-enoylphenyl) 2-oxoacetate?
The canonical SMILES for (2-prop-2-enoylphenyl) 2-oxoacetate is C=CC(=O)c1ccccc1OC(=O)C=O.
What is the InChIKey of (2-prop-2-enoylphenyl) 2-oxoacetate?
The InChIKey is XMDHVGWNVHEWSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8O4/c1-2-9(13)8-5-3-4-6-10(8)15-11(14)7-12/h2-7H,1H2.
What are the key properties of (2-prop-2-enoylphenyl) 2-oxoacetate?
(2-prop-2-enoylphenyl) 2-oxoacetate has a molecular weight of 204.18 g/mol, XLogP of 1.16, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-prop-2-enoylphenyl) 2-oxoacetate is sourced from PubChem (CID 87741605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).