About phthalic acid;prop-2-eneperoxoic acid
phthalic acid;prop-2-eneperoxoic acid (PubChem CID 159200094) has the molecular formula C11H10O7
and a molecular weight of 254.19 g/mol. Its IUPAC name is phthalic acid;prop-2-eneperoxoic acid.
Molecular Properties
| Compound Name | phthalic acid;prop-2-eneperoxoic acid |
| PubChem CID | 159200094 |
| Molecular Formula | C11H10O7 |
| Molecular Weight | 254.19 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | phthalic acid;prop-2-eneperoxoic acid |
| SMILES | C=CC(=O)OO.O=C(O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C8H6O4.C3H4O3/c9-7(10)5-3-1-2-4-6(5)8(11)12;1-2-3(4)6-5/h1-4H,(H,9,10)(H,11,12);2,5H,1H2 |
| InChIKey | KPEFKSZMAXCYOQ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.19 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze phthalic acid;prop-2-eneperoxoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phthalic acid;prop-2-eneperoxoic acid?
The IUPAC name of phthalic acid;prop-2-eneperoxoic acid (CID 159200094) is phthalic acid;prop-2-eneperoxoic acid.
What is the SMILES notation for phthalic acid;prop-2-eneperoxoic acid?
The canonical SMILES for phthalic acid;prop-2-eneperoxoic acid is C=CC(=O)OO.O=C(O)c1ccccc1C(=O)O.
What is the InChIKey of phthalic acid;prop-2-eneperoxoic acid?
The InChIKey is KPEFKSZMAXCYOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O4.C3H4O3/c9-7(10)5-3-1-2-4-6(5)8(11)12;1-2-3(4)6-5/h1-4H,(H,9,10)(H,11,12);2,5H,1H2.
What are the key properties of phthalic acid;prop-2-eneperoxoic acid?
phthalic acid;prop-2-eneperoxoic acid has a molecular weight of 254.19 g/mol, XLogP of 1.27, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for phthalic acid;prop-2-eneperoxoic acid is sourced from PubChem (CID 159200094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).