C33H28O4 — CID 147077770
bis(2-prop-2-enylphenyl) 4-prop-2-enylnaphthalene-2,6-dicarboxylate (PubChem CID 147077770) has the molecular formula C33H28O4 and a molecular weight of 488.58 g/mol. Its IUPAC name is bis(2-prop-2-enylphenyl) 4-prop-2-enylnaphthalene-2,6-dicarboxylate.
| Compound Name | bis(2-prop-2-enylphenyl) 4-prop-2-enylnaphthalene-2,6-dicarboxylate |
|---|---|
| PubChem CID | 147077770 |
| Molecular Formula | C33H28O4 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | bis(2-prop-2-enylphenyl) 4-prop-2-enylnaphthalene-2,6-dicarboxylate |
| SMILES | C=CCc1ccccc1OC(=O)c1cc(CC=C)c2cc(C(=O)Oc3ccccc3CC=C)ccc2c1 |
| InChI | InChI=1S/C33H28O4/c1-4-11-23-14-7-9-16-30(23)36-32(34)27-19-18-26-21-28(20-25(13-6-3)29(26)22-27)33(35)37-31-17-10-8-15-24(31)12-5-2/h4-10,14-22H,1-3,11-13H2 |
| InChIKey | BGHWPZFTWZNATO-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|