C17H16O3 — CID 2252771
4-[(2-prop-2-enylphenoxy)methyl]benzoic acid (PubChem CID 2252771) has the molecular formula C17H16O3 and a molecular weight of 268.31 g/mol. Its IUPAC name is 4-[(2-prop-2-enylphenoxy)methyl]benzoic acid.
| Compound Name | 4-[(2-prop-2-enylphenoxy)methyl]benzoic acid |
|---|---|
| PubChem CID | 2252771 |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 4-[(2-prop-2-enylphenoxy)methyl]benzoic acid |
| SMILES | C=CCc1ccccc1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C17H16O3/c1-2-5-14-6-3-4-7-16(14)20-12-13-8-10-15(11-9-13)17(18)19/h2-4,6-11H,1,5,12H2,(H,18,19) |
| InChIKey | FKZJQQFOABZGMD-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|