C22H21ClFNO3 — CID 17294879
4-[[[2-[(4-fluorophenyl)methoxy]phenyl]methylamino]methyl]benzoic acid;hydrochloride (PubChem CID 17294879) has the molecular formula C22H21ClFNO3 and a molecular weight of 401.87 g/mol. Its IUPAC name is 4-[[[2-[(4-fluorophenyl)methoxy]phenyl]methylamino]methyl]benzoic acid;hydrochloride.
| Compound Name | 4-[[[2-[(4-fluorophenyl)methoxy]phenyl]methylamino]methyl]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 17294879 |
| Molecular Formula | C22H21ClFNO3 |
| Molecular Weight | 401.87 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 4-[[[2-[(4-fluorophenyl)methoxy]phenyl]methylamino]methyl]benzoic acid;hydrochloride |
| SMILES | Cl.O=C(O)c1ccc(CNCc2ccccc2OCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C22H20FNO3.ClH/c23-20-11-7-17(8-12-20)15-27-21-4-2-1-3-19(21)14-24-13-16-5-9-18(10-6-16)22(25)26;/h1-12,24H,13-15H2,(H,25,26);1H |
| InChIKey | URPMIUUZAKLHPS-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.87 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |