C16H18ClNO2 — CID 6459710
4-[[(2-methylphenyl)methylamino]methyl]benzoic acid;hydrochloride (PubChem CID 6459710) has the molecular formula C16H18ClNO2 and a molecular weight of 291.78 g/mol. Its IUPAC name is 4-[[(2-methylphenyl)methylamino]methyl]benzoic acid;hydrochloride.
| Compound Name | 4-[[(2-methylphenyl)methylamino]methyl]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 6459710 |
| Molecular Formula | C16H18ClNO2 |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 4-[[(2-methylphenyl)methylamino]methyl]benzoic acid;hydrochloride |
| SMILES | Cc1ccccc1CNCc1ccc(C(=O)O)cc1.Cl |
| InChI | InChI=1S/C16H17NO2.ClH/c1-12-4-2-3-5-15(12)11-17-10-13-6-8-14(9-7-13)16(18)19;/h2-9,17H,10-11H2,1H3,(H,18,19);1H |
| InChIKey | HMMBHDNXWAUXRN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |