C17H20ClNO2 — CID 2988484
4-[[(4-ethylphenyl)methylamino]methyl]benzoic acid;hydrochloride (PubChem CID 2988484) has the molecular formula C17H20ClNO2 and a molecular weight of 305.81 g/mol. Its IUPAC name is 4-[[(4-ethylphenyl)methylamino]methyl]benzoic acid;hydrochloride.
| Compound Name | 4-[[(4-ethylphenyl)methylamino]methyl]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 2988484 |
| Molecular Formula | C17H20ClNO2 |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 4-[[(4-ethylphenyl)methylamino]methyl]benzoic acid;hydrochloride |
| SMILES | CCc1ccc(CNCc2ccc(C(=O)O)cc2)cc1.Cl |
| InChI | InChI=1S/C17H19NO2.ClH/c1-2-13-3-5-14(6-4-13)11-18-12-15-7-9-16(10-8-15)17(19)20;/h3-10,18H,2,11-12H2,1H3,(H,19,20);1H |
| InChIKey | UIAZJTIBRHZKEA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |