C12H20Cl2N2O2 — CID 17159605
4-[[3-(methylamino)propylamino]methyl]benzoic acid;dihydrochloride (PubChem CID 17159605) has the molecular formula C12H20Cl2N2O2 and a molecular weight of 295.21 g/mol. Its IUPAC name is 4-[[3-(methylamino)propylamino]methyl]benzoic acid;dihydrochloride.
| Compound Name | 4-[[3-(methylamino)propylamino]methyl]benzoic acid;dihydrochloride |
|---|---|
| PubChem CID | 17159605 |
| Molecular Formula | C12H20Cl2N2O2 |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 4-[[3-(methylamino)propylamino]methyl]benzoic acid;dihydrochloride |
| SMILES | CNCCCNCc1ccc(C(=O)O)cc1.Cl.Cl |
| InChI | InChI=1S/C12H18N2O2.2ClH/c1-13-7-2-8-14-9-10-3-5-11(6-4-10)12(15)16;;/h3-6,13-14H,2,7-9H2,1H3,(H,15,16);2*1H |
| InChIKey | LYCSIXBYDQLCKZ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|