C10H14NO5P — CID 154020772
4-[(2-phosphonoethylamino)methyl]benzoic acid (PubChem CID 154020772) has the molecular formula C10H14NO5P and a molecular weight of 259.20 g/mol. Its IUPAC name is 4-[(2-phosphonoethylamino)methyl]benzoic acid.
| Compound Name | 4-[(2-phosphonoethylamino)methyl]benzoic acid |
|---|---|
| PubChem CID | 154020772 |
| Molecular Formula | C10H14NO5P |
| Molecular Weight | 259.20 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 4-[(2-phosphonoethylamino)methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNCCP(=O)(O)O)cc1 |
| InChI | InChI=1S/C10H14NO5P/c12-10(13)9-3-1-8(2-4-9)7-11-5-6-17(14,15)16/h1-4,11H,5-7H2,(H,12,13)(H2,14,15,16) |
| InChIKey | JTLDVOIZHSDIMJ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.20 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|