C19H32NO4P — CID 10172513
3-[(4-nonanoylphenyl)methylamino]propylphosphonic acid (PubChem CID 10172513) has the molecular formula C19H32NO4P and a molecular weight of 369.44 g/mol. Its IUPAC name is 3-[(4-nonanoylphenyl)methylamino]propylphosphonic acid.
| Compound Name | 3-[(4-nonanoylphenyl)methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 10172513 |
| Molecular Formula | C19H32NO4P |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 3-[(4-nonanoylphenyl)methylamino]propylphosphonic acid |
| SMILES | CCCCCCCCC(=O)c1ccc(CNCCCP(=O)(O)O)cc1 |
| InChI | InChI=1S/C19H32NO4P/c1-2-3-4-5-6-7-9-19(21)18-12-10-17(11-13-18)16-20-14-8-15-25(22,23)24/h10-13,20H,2-9,14-16H2,1H3,(H2,22,23,24) |
| InChIKey | NSEVTFLGGHULPD-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|