C21H38NO3P — CID 59691756
1-hydroxyethyl-[3-[(4-nonylphenyl)methylamino]propyl]phosphinic acid (PubChem CID 59691756) has the molecular formula C21H38NO3P and a molecular weight of 383.51 g/mol. Its IUPAC name is 1-hydroxyethyl-[3-[(4-nonylphenyl)methylamino]propyl]phosphinic acid.
| Compound Name | 1-hydroxyethyl-[3-[(4-nonylphenyl)methylamino]propyl]phosphinic acid |
|---|---|
| PubChem CID | 59691756 |
| Molecular Formula | C21H38NO3P |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | 1-hydroxyethyl-[3-[(4-nonylphenyl)methylamino]propyl]phosphinic acid |
| SMILES | CCCCCCCCCc1ccc(CNCCCP(=O)(O)C(C)O)cc1 |
| InChI | InChI=1S/C21H38NO3P/c1-3-4-5-6-7-8-9-11-20-12-14-21(15-13-20)18-22-16-10-17-26(24,25)19(2)23/h12-15,19,22-23H,3-11,16-18H2,1-2H3,(H,24,25) |
| InChIKey | UYIWAWKPNIXCIB-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|