About formaldehyde;methanol;N-[(4-nonylphenyl)methyl]butan-1-amine
formaldehyde;methanol;N-[(4-nonylphenyl)methyl]butan-1-amine (PubChem CID 142267456) has the molecular formula C23H45NO3
and a molecular weight of 383.62 g/mol. Its IUPAC name is formaldehyde;methanol;N-[(4-nonylphenyl)methyl]butan-1-amine.
Molecular Properties
| Compound Name | formaldehyde;methanol;N-[(4-nonylphenyl)methyl]butan-1-amine |
| PubChem CID | 142267456 |
| Molecular Formula | C23H45NO3 |
| Molecular Weight | 383.62 g/mol |
| Exact Mass | 383.34 |
| IUPAC Name | formaldehyde;methanol;N-[(4-nonylphenyl)methyl]butan-1-amine |
| SMILES | C=O.CCCCCCCCCc1ccc(CNCCCC)cc1.CO.CO |
| InChI | InChI=1S/C20H35N.2CH4O.CH2O/c1-3-5-7-8-9-10-11-12-19-13-15-20(16-14-19)18-21-17-6-4-2;3*1-2/h13-16,21H,3-12,17-18H2,1-2H3;2*2H,1H3;1H2 |
| InChIKey | VZKFFYQUFLZYMP-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.62 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze formaldehyde;methanol;N-[(4-nonylphenyl)methyl]butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;methanol;N-[(4-nonylphenyl)methyl]butan-1-amine?
The IUPAC name of formaldehyde;methanol;N-[(4-nonylphenyl)methyl]butan-1-amine (CID 142267456) is formaldehyde;methanol;N-[(4-nonylphenyl)methyl]butan-1-amine.
What is the SMILES notation for formaldehyde;methanol;N-[(4-nonylphenyl)methyl]butan-1-amine?
The canonical SMILES for formaldehyde;methanol;N-[(4-nonylphenyl)methyl]butan-1-amine is C=O.CCCCCCCCCc1ccc(CNCCCC)cc1.CO.CO.
What is the InChIKey of formaldehyde;methanol;N-[(4-nonylphenyl)methyl]butan-1-amine?
The InChIKey is VZKFFYQUFLZYMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H35N.2CH4O.CH2O/c1-3-5-7-8-9-10-11-12-19-13-15-20(16-14-19)18-21-17-6-4-2;3*1-2/h13-16,21H,3-12,17-18H2,1-2H3;2*2H,1H3;1H2.
What are the key properties of formaldehyde;methanol;N-[(4-nonylphenyl)methyl]butan-1-amine?
formaldehyde;methanol;N-[(4-nonylphenyl)methyl]butan-1-amine has a molecular weight of 383.62 g/mol, XLogP of 4.90, 13 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;methanol;N-[(4-nonylphenyl)methyl]butan-1-amine is sourced from PubChem (CID 142267456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).