C23H41NO3 — CID 142267639
methanediol;4-[(4-undecylphenyl)methylamino]butanal (PubChem CID 142267639) has the molecular formula C23H41NO3 and a molecular weight of 379.59 g/mol. Its IUPAC name is methanediol;4-[(4-undecylphenyl)methylamino]butanal.
| Compound Name | methanediol;4-[(4-undecylphenyl)methylamino]butanal |
|---|---|
| PubChem CID | 142267639 |
| Molecular Formula | C23H41NO3 |
| Molecular Weight | 379.59 g/mol |
| Exact Mass | 379.31 |
| IUPAC Name | methanediol;4-[(4-undecylphenyl)methylamino]butanal |
| SMILES | CCCCCCCCCCCc1ccc(CNCCCC=O)cc1.OCO |
| InChI | InChI=1S/C22H37NO.CH4O2/c1-2-3-4-5-6-7-8-9-10-13-21-14-16-22(17-15-21)20-23-18-11-12-19-24;2-1-3/h14-17,19,23H,2-13,18,20H2,1H3;2-3H,1H2 |
| InChIKey | YYXLHHRWPUDHQQ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.59 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|