C21H38N2 — CID 71329852
N'-[(4-dodecylphenyl)methyl]ethane-1,2-diamine (PubChem CID 71329852) has the molecular formula C21H38N2 and a molecular weight of 318.55 g/mol. Its IUPAC name is N'-[(4-dodecylphenyl)methyl]ethane-1,2-diamine.
| Compound Name | N'-[(4-dodecylphenyl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 71329852 |
| Molecular Formula | C21H38N2 |
| Molecular Weight | 318.55 g/mol |
| Exact Mass | 318.30 |
| IUPAC Name | N'-[(4-dodecylphenyl)methyl]ethane-1,2-diamine |
| SMILES | CCCCCCCCCCCCc1ccc(CNCCN)cc1 |
| InChI | InChI=1S/C21H38N2/c1-2-3-4-5-6-7-8-9-10-11-12-20-13-15-21(16-14-20)19-23-18-17-22/h13-16,23H,2-12,17-19,22H2,1H3 |
| InChIKey | CNNKEMRPUMZJMZ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.55 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|