C22H42N4O — CID 72713336
2-[[2-[2-(2-aminoethylamino)ethylamino]ethylamino]methyl]-4-nonylphenol (PubChem CID 72713336) has the molecular formula C22H42N4O and a molecular weight of 378.61 g/mol. Its IUPAC name is 2-[[2-[2-(2-aminoethylamino)ethylamino]ethylamino]methyl]-4-nonylphenol.
| Compound Name | 2-[[2-[2-(2-aminoethylamino)ethylamino]ethylamino]methyl]-4-nonylphenol |
|---|---|
| PubChem CID | 72713336 |
| Molecular Formula | C22H42N4O |
| Molecular Weight | 378.61 g/mol |
| Exact Mass | 378.34 |
| IUPAC Name | 2-[[2-[2-(2-aminoethylamino)ethylamino]ethylamino]methyl]-4-nonylphenol |
| SMILES | CCCCCCCCCc1ccc(O)c(CNCCNCCNCCN)c1 |
| InChI | InChI=1S/C22H42N4O/c1-2-3-4-5-6-7-8-9-20-10-11-22(27)21(18-20)19-26-17-16-25-15-14-24-13-12-23/h10-11,18,24-27H,2-9,12-17,19,23H2,1H3 |
| InChIKey | SWZJUCCIYXLIDH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 82.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.61 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|