C20H28N2O2 — CID 3843205
4-ethyl-2-[[2-[(5-ethyl-2-hydroxyphenyl)methylamino]ethylamino]methyl]phenol (PubChem CID 3843205) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 4-ethyl-2-[[2-[(5-ethyl-2-hydroxyphenyl)methylamino]ethylamino]methyl]phenol.
| Compound Name | 4-ethyl-2-[[2-[(5-ethyl-2-hydroxyphenyl)methylamino]ethylamino]methyl]phenol |
|---|---|
| PubChem CID | 3843205 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 4-ethyl-2-[[2-[(5-ethyl-2-hydroxyphenyl)methylamino]ethylamino]methyl]phenol |
| SMILES | CCc1ccc(O)c(CNCCNCc2cc(CC)ccc2O)c1 |
| InChI | InChI=1S/C20H28N2O2/c1-3-15-5-7-19(23)17(11-15)13-21-9-10-22-14-18-12-16(4-2)6-8-20(18)24/h5-8,11-12,21-24H,3-4,9-10,13-14H2,1-2H3 |
| InChIKey | KYIAUZRDCLQACY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|