C26H36N2O6 — CID 164907293
3-[4-hydroxy-3-[[2-[[2-hydroxy-5-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]phenyl]methylamino]ethylamino]methyl]phenyl]propanoic acid (PubChem CID 164907293) has the molecular formula C26H36N2O6 and a molecular weight of 472.58 g/mol. Its IUPAC name is 3-[4-hydroxy-3-[[2-[[2-hydroxy-5-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]phenyl]methylamino]ethylamino]methyl]phenyl]propanoic acid.
| Compound Name | 3-[4-hydroxy-3-[[2-[[2-hydroxy-5-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]phenyl]methylamino]ethylamino]methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 164907293 |
| Molecular Formula | C26H36N2O6 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | 3-[4-hydroxy-3-[[2-[[2-hydroxy-5-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]phenyl]methylamino]ethylamino]methyl]phenyl]propanoic acid |
| SMILES | CC(C)(C)OC(=O)CCc1ccc(O)c(CNCCNCc2cc(CCC(=O)O)ccc2O)c1 |
| InChI | InChI=1S/C26H36N2O6/c1-26(2,3)34-25(33)11-7-19-5-9-23(30)21(15-19)17-28-13-12-27-16-20-14-18(4-8-22(20)29)6-10-24(31)32/h4-5,8-9,14-15,27-30H,6-7,10-13,16-17H2,1-3H3,(H,31,32) |
| InChIKey | XXNGMJCNMNXHRV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 128.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|