C19H33NO5 — CID 101326369
2-[2,2-dihydroxyethyl-[(2-hydroxy-5-octylphenyl)methyl]amino]ethane-1,1-diol (PubChem CID 101326369) has the molecular formula C19H33NO5 and a molecular weight of 355.48 g/mol. Its IUPAC name is 2-[2,2-dihydroxyethyl-[(2-hydroxy-5-octylphenyl)methyl]amino]ethane-1,1-diol.
| Compound Name | 2-[2,2-dihydroxyethyl-[(2-hydroxy-5-octylphenyl)methyl]amino]ethane-1,1-diol |
|---|---|
| PubChem CID | 101326369 |
| Molecular Formula | C19H33NO5 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | 2-[2,2-dihydroxyethyl-[(2-hydroxy-5-octylphenyl)methyl]amino]ethane-1,1-diol |
| SMILES | CCCCCCCCc1ccc(O)c(CN(CC(O)O)CC(O)O)c1 |
| InChI | InChI=1S/C19H33NO5/c1-2-3-4-5-6-7-8-15-9-10-17(21)16(11-15)12-20(13-18(22)23)14-19(24)25/h9-11,18-19,21-25H,2-8,12-14H2,1H3 |
| InChIKey | ZBORJOVGNFNQDT-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|