C33H61NO — CID 23346787
2-[[bis(2-methylpropyl)amino]methyl]-4,6-di(nonyl)phenol (PubChem CID 23346787) has the molecular formula C33H61NO and a molecular weight of 487.86 g/mol. Its IUPAC name is 2-[[bis(2-methylpropyl)amino]methyl]-4,6-di(nonyl)phenol.
| Compound Name | 2-[[bis(2-methylpropyl)amino]methyl]-4,6-di(nonyl)phenol |
|---|---|
| PubChem CID | 23346787 |
| Molecular Formula | C33H61NO |
| Molecular Weight | 487.86 g/mol |
| Exact Mass | 487.48 |
| IUPAC Name | 2-[[bis(2-methylpropyl)amino]methyl]-4,6-di(nonyl)phenol |
| SMILES | CCCCCCCCCc1cc(CCCCCCCCC)c(O)c(CN(CC(C)C)CC(C)C)c1 |
| InChI | InChI=1S/C33H61NO/c1-7-9-11-13-15-17-19-21-30-23-31(22-20-18-16-14-12-10-8-2)33(35)32(24-30)27-34(25-28(3)4)26-29(5)6/h23-24,28-29,35H,7-22,25-27H2,1-6H3 |
| InChIKey | LOBHJTRTUJEVRL-UHFFFAOYSA-N |
| XLogP | 10.09 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.86 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|