C15H27N3 — CID 58260406
N'-[[4-(5-aminopentyl)phenyl]methyl]propane-1,3-diamine (PubChem CID 58260406) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is N'-[[4-(5-aminopentyl)phenyl]methyl]propane-1,3-diamine.
| Compound Name | N'-[[4-(5-aminopentyl)phenyl]methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 58260406 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | N'-[[4-(5-aminopentyl)phenyl]methyl]propane-1,3-diamine |
| SMILES | NCCCCCc1ccc(CNCCCN)cc1 |
| InChI | InChI=1S/C15H27N3/c16-10-3-1-2-5-14-6-8-15(9-7-14)13-18-12-4-11-17/h6-9,18H,1-5,10-13,16-17H2 |
| InChIKey | YVLMDHGSRQYNCM-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|