C19H29N3 — CID 23298616
N-benzyl-2-phenylethanamine;butane-1,4-diamine (PubChem CID 23298616) has the molecular formula C19H29N3 and a molecular weight of 299.46 g/mol. Its IUPAC name is N-benzyl-2-phenylethanamine;butane-1,4-diamine.
| Compound Name | N-benzyl-2-phenylethanamine;butane-1,4-diamine |
|---|---|
| PubChem CID | 23298616 |
| Molecular Formula | C19H29N3 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.24 |
| IUPAC Name | N-benzyl-2-phenylethanamine;butane-1,4-diamine |
| SMILES | NCCCCN.c1ccc(CCNCc2ccccc2)cc1 |
| InChI | InChI=1S/C15H17N.C4H12N2/c1-3-7-14(8-4-1)11-12-16-13-15-9-5-2-6-10-15;5-3-1-2-4-6/h1-10,16H,11-13H2;1-6H2 |
| InChIKey | AQMOUKYSWCGWKR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|