About N-benzyl-2-phenylethanamine;isothiocyanic acid
N-benzyl-2-phenylethanamine;isothiocyanic acid (PubChem CID 87452788) has the molecular formula C16H18N2S
and a molecular weight of 270.40 g/mol. Its IUPAC name is N-benzyl-2-phenylethanamine;isothiocyanic acid.
Molecular Properties
| Compound Name | N-benzyl-2-phenylethanamine;isothiocyanic acid |
| PubChem CID | 87452788 |
| Molecular Formula | C16H18N2S |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | N-benzyl-2-phenylethanamine;isothiocyanic acid |
| SMILES | N=C=S.c1ccc(CCNCc2ccccc2)cc1 |
| InChI | InChI=1S/C15H17N.CHNS/c1-3-7-14(8-4-1)11-12-16-13-15-9-5-2-6-10-15;2-1-3/h1-10,16H,11-13H2;2H |
| InChIKey | MTFFAYYIWDNMSA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-2-phenylethanamine;isothiocyanic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2-phenylethanamine;isothiocyanic acid?
The IUPAC name of N-benzyl-2-phenylethanamine;isothiocyanic acid (CID 87452788) is N-benzyl-2-phenylethanamine;isothiocyanic acid.
What is the SMILES notation for N-benzyl-2-phenylethanamine;isothiocyanic acid?
The canonical SMILES for N-benzyl-2-phenylethanamine;isothiocyanic acid is N=C=S.c1ccc(CCNCc2ccccc2)cc1.
What is the InChIKey of N-benzyl-2-phenylethanamine;isothiocyanic acid?
The InChIKey is MTFFAYYIWDNMSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N.CHNS/c1-3-7-14(8-4-1)11-12-16-13-15-9-5-2-6-10-15;2-1-3/h1-10,16H,11-13H2;2H.
What are the key properties of N-benzyl-2-phenylethanamine;isothiocyanic acid?
N-benzyl-2-phenylethanamine;isothiocyanic acid has a molecular weight of 270.40 g/mol, XLogP of 3.69, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2-phenylethanamine;isothiocyanic acid is sourced from PubChem (CID 87452788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).