N-benzyl-2-phenylethanamine;isothiocyanic acid

C16H18N2S — CID 87452788

IUPACN-benzyl-2-phenylethanamine;isothiocyanic acid
SMILESN=C=S.c1ccc(CCNCc2ccccc2)cc1
InChIInChI=1S/C15H17N.CHNS/c1-3-7-14(8-4-1)11-12-16-13-15-9-5-2-6-10-15;2-1-3/h1-10,16H,11-13H2;2H
InChIKeyMTFFAYYIWDNMSA-UHFFFAOYSA-N
MW270.40 g/mol
LogP3.69
Rot. Bonds5

About N-benzyl-2-phenylethanamine;isothiocyanic acid

N-benzyl-2-phenylethanamine;isothiocyanic acid (PubChem CID 87452788) has the molecular formula C16H18N2S and a molecular weight of 270.40 g/mol. Its IUPAC name is N-benzyl-2-phenylethanamine;isothiocyanic acid.

Molecular Properties

Compound NameN-benzyl-2-phenylethanamine;isothiocyanic acid
PubChem CID87452788
Molecular FormulaC16H18N2S
Molecular Weight270.40 g/mol
Exact Mass270.12
IUPAC NameN-benzyl-2-phenylethanamine;isothiocyanic acid
SMILESN=C=S.c1ccc(CCNCc2ccccc2)cc1
InChIInChI=1S/C15H17N.CHNS/c1-3-7-14(8-4-1)11-12-16-13-15-9-5-2-6-10-15;2-1-3/h1-10,16H,11-13H2;2H
InChIKeyMTFFAYYIWDNMSA-UHFFFAOYSA-N
XLogP3.69
TPSA35.88 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.40
LogP ≤ 53.69
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}

Analyze N-benzyl-2-phenylethanamine;isothiocyanic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-benzyl-2-phenylethanamine;isothiocyanic acid?
The IUPAC name of N-benzyl-2-phenylethanamine;isothiocyanic acid (CID 87452788) is N-benzyl-2-phenylethanamine;isothiocyanic acid.
What is the SMILES notation for N-benzyl-2-phenylethanamine;isothiocyanic acid?
The canonical SMILES for N-benzyl-2-phenylethanamine;isothiocyanic acid is N=C=S.c1ccc(CCNCc2ccccc2)cc1.
What is the InChIKey of N-benzyl-2-phenylethanamine;isothiocyanic acid?
The InChIKey is MTFFAYYIWDNMSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N.CHNS/c1-3-7-14(8-4-1)11-12-16-13-15-9-5-2-6-10-15;2-1-3/h1-10,16H,11-13H2;2H.
What are the key properties of N-benzyl-2-phenylethanamine;isothiocyanic acid?
N-benzyl-2-phenylethanamine;isothiocyanic acid has a molecular weight of 270.40 g/mol, XLogP of 3.69, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2-phenylethanamine;isothiocyanic acid is sourced from PubChem (CID 87452788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).