C16H27NO4P+ — CID 123781472
3-[(4-hexylphenyl)methylamino]propanoyl-trihydroxyphosphanium (PubChem CID 123781472) has the molecular formula C16H27NO4P+ and a molecular weight of 328.37 g/mol. Its IUPAC name is 3-[(4-hexylphenyl)methylamino]propanoyl-trihydroxyphosphanium.
| Compound Name | 3-[(4-hexylphenyl)methylamino]propanoyl-trihydroxyphosphanium |
|---|---|
| PubChem CID | 123781472 |
| Molecular Formula | C16H27NO4P+ |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 3-[(4-hexylphenyl)methylamino]propanoyl-trihydroxyphosphanium |
| SMILES | CCCCCCc1ccc(CNCCC(=O)[P+](O)(O)O)cc1 |
| InChI | InChI=1S/C16H27NO4P/c1-2-3-4-5-6-14-7-9-15(10-8-14)13-17-12-11-16(18)22(19,20)21/h7-10,17,19-21H,2-6,11-13H2,1H3/q+1 |
| InChIKey | OBULATQQJYJPDM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|