C19H34NO4P — CID 10287092
3-[[4-(octoxymethyl)phenyl]methylamino]propylphosphonic acid (PubChem CID 10287092) has the molecular formula C19H34NO4P and a molecular weight of 371.46 g/mol. Its IUPAC name is 3-[[4-(octoxymethyl)phenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[4-(octoxymethyl)phenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 10287092 |
| Molecular Formula | C19H34NO4P |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 3-[[4-(octoxymethyl)phenyl]methylamino]propylphosphonic acid |
| SMILES | CCCCCCCCOCc1ccc(CNCCCP(=O)(O)O)cc1 |
| InChI | InChI=1S/C19H34NO4P/c1-2-3-4-5-6-7-14-24-17-19-11-9-18(10-12-19)16-20-13-8-15-25(21,22)23/h9-12,20H,2-8,13-17H2,1H3,(H2,21,22,23) |
| InChIKey | OPORCTNASSCNSE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|