C19H33ClNO5P — CID 10173327
3-[(3-chloro-5-methoxy-4-octoxyphenyl)methylamino]propylphosphonic acid (PubChem CID 10173327) has the molecular formula C19H33ClNO5P and a molecular weight of 421.90 g/mol. Its IUPAC name is 3-[(3-chloro-5-methoxy-4-octoxyphenyl)methylamino]propylphosphonic acid.
| Compound Name | 3-[(3-chloro-5-methoxy-4-octoxyphenyl)methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 10173327 |
| Molecular Formula | C19H33ClNO5P |
| Molecular Weight | 421.90 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 3-[(3-chloro-5-methoxy-4-octoxyphenyl)methylamino]propylphosphonic acid |
| SMILES | CCCCCCCCOc1c(Cl)cc(CNCCCP(=O)(O)O)cc1OC |
| InChI | InChI=1S/C19H33ClNO5P/c1-3-4-5-6-7-8-11-26-19-17(20)13-16(14-18(19)25-2)15-21-10-9-12-27(22,23)24/h13-14,21H,3-12,15H2,1-2H3,(H2,22,23,24) |
| InChIKey | GBAYNJCGVHFQTM-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.90 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|