C16H27ClN2O2 — CID 29241800
N-[(3-chloro-5-methoxy-4-propoxyphenyl)methyl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 29241800) has the molecular formula C16H27ClN2O2 and a molecular weight of 314.86 g/mol. Its IUPAC name is N-[(3-chloro-5-methoxy-4-propoxyphenyl)methyl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[(3-chloro-5-methoxy-4-propoxyphenyl)methyl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 29241800 |
| Molecular Formula | C16H27ClN2O2 |
| Molecular Weight | 314.86 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | N-[(3-chloro-5-methoxy-4-propoxyphenyl)methyl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CCCOc1c(Cl)cc(CNCCCN(C)C)cc1OC |
| InChI | InChI=1S/C16H27ClN2O2/c1-5-9-21-16-14(17)10-13(11-15(16)20-4)12-18-7-6-8-19(2)3/h10-11,18H,5-9,12H2,1-4H3 |
| InChIKey | SNLKUWUUQLMCQF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.86 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|