C14H22ClNO4 — CID 63062852
N-[[3-chloro-5-methoxy-4-(2-methoxyethoxy)phenyl]methyl]-2-methoxyethanamine (PubChem CID 63062852) has the molecular formula C14H22ClNO4 and a molecular weight of 303.79 g/mol. Its IUPAC name is N-[[3-chloro-5-methoxy-4-(2-methoxyethoxy)phenyl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[3-chloro-5-methoxy-4-(2-methoxyethoxy)phenyl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 63062852 |
| Molecular Formula | C14H22ClNO4 |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | N-[[3-chloro-5-methoxy-4-(2-methoxyethoxy)phenyl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1cc(Cl)c(OCCOC)c(OC)c1 |
| InChI | InChI=1S/C14H22ClNO4/c1-17-5-4-16-10-11-8-12(15)14(13(9-11)19-3)20-7-6-18-2/h8-9,16H,4-7,10H2,1-3H3 |
| InChIKey | RXPCEMVFPJTQSW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|