C14H18Cl3NO3 — CID 79166838
N-[[3-chloro-4-(2,3-dichloroprop-2-enoxy)-5-methoxyphenyl]methyl]-2-methoxyethanamine (PubChem CID 79166838) has the molecular formula C14H18Cl3NO3 and a molecular weight of 354.66 g/mol. Its IUPAC name is N-[[3-chloro-4-(2,3-dichloroprop-2-enoxy)-5-methoxyphenyl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[3-chloro-4-(2,3-dichloroprop-2-enoxy)-5-methoxyphenyl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 79166838 |
| Molecular Formula | C14H18Cl3NO3 |
| Molecular Weight | 354.66 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | N-[[3-chloro-4-(2,3-dichloroprop-2-enoxy)-5-methoxyphenyl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1cc(Cl)c(OCC(Cl)=CCl)c(OC)c1 |
| InChI | InChI=1S/C14H18Cl3NO3/c1-19-4-3-18-8-10-5-12(17)14(13(6-10)20-2)21-9-11(16)7-15/h5-7,18H,3-4,8-9H2,1-2H3 |
| InChIKey | DXCRYMYTXGDFDD-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.66 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|