C15H21Cl2NO3 — CID 106437144
N-[[5-chloro-2-[(E)-3-chloro-2-methylprop-2-enoxy]-3-methoxyphenyl]methyl]-2-methoxyethanamine (PubChem CID 106437144) has the molecular formula C15H21Cl2NO3 and a molecular weight of 334.24 g/mol. Its IUPAC name is N-[[5-chloro-2-[(E)-3-chloro-2-methylprop-2-enoxy]-3-methoxyphenyl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[5-chloro-2-[(E)-3-chloro-2-methylprop-2-enoxy]-3-methoxyphenyl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 106437144 |
| Molecular Formula | C15H21Cl2NO3 |
| Molecular Weight | 334.24 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | N-[[5-chloro-2-[(E)-3-chloro-2-methylprop-2-enoxy]-3-methoxyphenyl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1cc(Cl)cc(OC)c1OC/C(C)=C/Cl |
| InChI | InChI=1S/C15H21Cl2NO3/c1-11(8-16)10-21-15-12(9-18-4-5-19-2)6-13(17)7-14(15)20-3/h6-8,18H,4-5,9-10H2,1-3H3/b11-8+ |
| InChIKey | IGKGOPVEKGXJSE-DHZHZOJOSA-N |
| XLogP | 3.61 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.24 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|