C14H20ClNO5 — CID 104665197
2-[4-chloro-2-methoxy-6-[(2-methoxyethylamino)methyl]phenoxy]propanoic acid (PubChem CID 104665197) has the molecular formula C14H20ClNO5 and a molecular weight of 317.77 g/mol. Its IUPAC name is 2-[4-chloro-2-methoxy-6-[(2-methoxyethylamino)methyl]phenoxy]propanoic acid.
| Compound Name | 2-[4-chloro-2-methoxy-6-[(2-methoxyethylamino)methyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 104665197 |
| Molecular Formula | C14H20ClNO5 |
| Molecular Weight | 317.77 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 2-[4-chloro-2-methoxy-6-[(2-methoxyethylamino)methyl]phenoxy]propanoic acid |
| SMILES | COCCNCc1cc(Cl)cc(OC)c1OC(C)C(=O)O |
| InChI | InChI=1S/C14H20ClNO5/c1-9(14(17)18)21-13-10(8-16-4-5-19-2)6-11(15)7-12(13)20-3/h6-7,9,16H,4-5,8H2,1-3H3,(H,17,18) |
| InChIKey | SWICKYWBJDFZKA-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.77 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|