C15H23NO5 — CID 63055961
2-[2-ethoxy-6-[(2-methoxyethylamino)methyl]phenoxy]propanoic acid (PubChem CID 63055961) has the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. Its IUPAC name is 2-[2-ethoxy-6-[(2-methoxyethylamino)methyl]phenoxy]propanoic acid.
| Compound Name | 2-[2-ethoxy-6-[(2-methoxyethylamino)methyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 63055961 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 2-[2-ethoxy-6-[(2-methoxyethylamino)methyl]phenoxy]propanoic acid |
| SMILES | CCOc1cccc(CNCCOC)c1OC(C)C(=O)O |
| InChI | InChI=1S/C15H23NO5/c1-4-20-13-7-5-6-12(10-16-8-9-19-3)14(13)21-11(2)15(17)18/h5-7,11,16H,4,8-10H2,1-3H3,(H,17,18) |
| InChIKey | WXJCBFGZPYEXAW-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|