C13H20Cl2NO2- — CID 53347083
N-[(5-chloro-3-methoxy-2-propan-2-yloxyphenyl)methyl]ethanamine chloride (PubChem CID 53347083) has the molecular formula C13H20Cl2NO2- and a molecular weight of 293.21 g/mol. Its IUPAC name is N-[(5-chloro-3-methoxy-2-propan-2-yloxyphenyl)methyl]ethanamine chloride.
| Compound Name | N-[(5-chloro-3-methoxy-2-propan-2-yloxyphenyl)methyl]ethanamine chloride |
|---|---|
| PubChem CID | 53347083 |
| Molecular Formula | C13H20Cl2NO2- |
| Molecular Weight | 293.21 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | N-[(5-chloro-3-methoxy-2-propan-2-yloxyphenyl)methyl]ethanamine chloride |
| SMILES | CCNCc1cc(Cl)cc(OC)c1OC(C)C.[Cl-] |
| InChI | InChI=1S/C13H20ClNO2.ClH/c1-5-15-8-10-6-11(14)7-12(16-4)13(10)17-9(2)3;/h6-7,9,15H,5,8H2,1-4H3;1H/p-1 |
| InChIKey | QRRYWLDTLCDGCL-UHFFFAOYSA-M |
| XLogP | 0.25 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.21 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |