C16H26ClNO3 — CID 103032941
N-[[5-chloro-3-methoxy-2-(3-methoxy-3-methylbutoxy)phenyl]methyl]ethanamine (PubChem CID 103032941) has the molecular formula C16H26ClNO3 and a molecular weight of 315.84 g/mol. Its IUPAC name is N-[[5-chloro-3-methoxy-2-(3-methoxy-3-methylbutoxy)phenyl]methyl]ethanamine.
| Compound Name | N-[[5-chloro-3-methoxy-2-(3-methoxy-3-methylbutoxy)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 103032941 |
| Molecular Formula | C16H26ClNO3 |
| Molecular Weight | 315.84 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | N-[[5-chloro-3-methoxy-2-(3-methoxy-3-methylbutoxy)phenyl]methyl]ethanamine |
| SMILES | CCNCc1cc(Cl)cc(OC)c1OCCC(C)(C)OC |
| InChI | InChI=1S/C16H26ClNO3/c1-6-18-11-12-9-13(17)10-14(19-4)15(12)21-8-7-16(2,3)20-5/h9-10,18H,6-8,11H2,1-5H3 |
| InChIKey | IRURSDKZZHLTRA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.84 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |