C16H26BrNO2 — CID 103032918
N-[[5-bromo-2-(3-methoxy-3-methylbutoxy)-3-methylphenyl]methyl]ethanamine (PubChem CID 103032918) has the molecular formula C16H26BrNO2 and a molecular weight of 344.29 g/mol. Its IUPAC name is N-[[5-bromo-2-(3-methoxy-3-methylbutoxy)-3-methylphenyl]methyl]ethanamine.
| Compound Name | N-[[5-bromo-2-(3-methoxy-3-methylbutoxy)-3-methylphenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 103032918 |
| Molecular Formula | C16H26BrNO2 |
| Molecular Weight | 344.29 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | N-[[5-bromo-2-(3-methoxy-3-methylbutoxy)-3-methylphenyl]methyl]ethanamine |
| SMILES | CCNCc1cc(Br)cc(C)c1OCCC(C)(C)OC |
| InChI | InChI=1S/C16H26BrNO2/c1-6-18-11-13-10-14(17)9-12(2)15(13)20-8-7-16(3,4)19-5/h9-10,18H,6-8,11H2,1-5H3 |
| InChIKey | UYBGSFXREBQZTF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.29 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |