C15H24FNO2 — CID 103032899
N-[[3-fluoro-2-(3-methoxy-3-methylbutoxy)phenyl]methyl]ethanamine (PubChem CID 103032899) has the molecular formula C15H24FNO2 and a molecular weight of 269.36 g/mol. Its IUPAC name is N-[[3-fluoro-2-(3-methoxy-3-methylbutoxy)phenyl]methyl]ethanamine.
| Compound Name | N-[[3-fluoro-2-(3-methoxy-3-methylbutoxy)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 103032899 |
| Molecular Formula | C15H24FNO2 |
| Molecular Weight | 269.36 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | N-[[3-fluoro-2-(3-methoxy-3-methylbutoxy)phenyl]methyl]ethanamine |
| SMILES | CCNCc1cccc(F)c1OCCC(C)(C)OC |
| InChI | InChI=1S/C15H24FNO2/c1-5-17-11-12-7-6-8-13(16)14(12)19-10-9-15(2,3)18-4/h6-8,17H,5,9-11H2,1-4H3 |
| InChIKey | YIFKVMLBXYQIAU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |