C14H21ClO3 — CID 113438836
[5-chloro-2-(3,3-dimethylbutoxy)-3-methoxyphenyl]methanol (PubChem CID 113438836) has the molecular formula C14H21ClO3 and a molecular weight of 272.77 g/mol. Its IUPAC name is [5-chloro-2-(3,3-dimethylbutoxy)-3-methoxyphenyl]methanol.
| Compound Name | [5-chloro-2-(3,3-dimethylbutoxy)-3-methoxyphenyl]methanol |
|---|---|
| PubChem CID | 113438836 |
| Molecular Formula | C14H21ClO3 |
| Molecular Weight | 272.77 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | [5-chloro-2-(3,3-dimethylbutoxy)-3-methoxyphenyl]methanol |
| SMILES | COc1cc(Cl)cc(CO)c1OCCC(C)(C)C |
| InChI | InChI=1S/C14H21ClO3/c1-14(2,3)5-6-18-13-10(9-16)7-11(15)8-12(13)17-4/h7-8,16H,5-6,9H2,1-4H3 |
| InChIKey | GEBQDDJEXOXTIH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.77 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |