C10H13ClO4 — CID 104666066
2-[4-chloro-2-(hydroxymethyl)-6-methoxyphenoxy]ethanol (PubChem CID 104666066) has the molecular formula C10H13ClO4 and a molecular weight of 232.66 g/mol. Its IUPAC name is 2-[4-chloro-2-(hydroxymethyl)-6-methoxyphenoxy]ethanol.
| Compound Name | 2-[4-chloro-2-(hydroxymethyl)-6-methoxyphenoxy]ethanol |
|---|---|
| PubChem CID | 104666066 |
| Molecular Formula | C10H13ClO4 |
| Molecular Weight | 232.66 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 2-[4-chloro-2-(hydroxymethyl)-6-methoxyphenoxy]ethanol |
| SMILES | COc1cc(Cl)cc(CO)c1OCCO |
| InChI | InChI=1S/C10H13ClO4/c1-14-9-5-8(11)4-7(6-13)10(9)15-3-2-12/h4-5,12-13H,2-3,6H2,1H3 |
| InChIKey | BYHGAVQAEOPVSZ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.66 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |