C13H18ClNO4 — CID 104666110
2-[4-chloro-2-(hydroxymethyl)-6-methoxyphenoxy]-N-propan-2-ylacetamide (PubChem CID 104666110) has the molecular formula C13H18ClNO4 and a molecular weight of 287.74 g/mol. Its IUPAC name is 2-[4-chloro-2-(hydroxymethyl)-6-methoxyphenoxy]-N-propan-2-ylacetamide.
| Compound Name | 2-[4-chloro-2-(hydroxymethyl)-6-methoxyphenoxy]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 104666110 |
| Molecular Formula | C13H18ClNO4 |
| Molecular Weight | 287.74 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 2-[4-chloro-2-(hydroxymethyl)-6-methoxyphenoxy]-N-propan-2-ylacetamide |
| SMILES | COc1cc(Cl)cc(CO)c1OCC(=O)NC(C)C |
| InChI | InChI=1S/C13H18ClNO4/c1-8(2)15-12(17)7-19-13-9(6-16)4-10(14)5-11(13)18-3/h4-5,8,16H,6-7H2,1-3H3,(H,15,17) |
| InChIKey | STAPVTZNTUNKEH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.74 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |