C11H14Cl3NO3 — CID 131860957
N-propan-2-yl-2-(2,4,6-trichlorophenoxy)acetamide;hydrate (PubChem CID 131860957) has the molecular formula C11H14Cl3NO3 and a molecular weight of 314.60 g/mol. Its IUPAC name is N-propan-2-yl-2-(2,4,6-trichlorophenoxy)acetamide;hydrate.
| Compound Name | N-propan-2-yl-2-(2,4,6-trichlorophenoxy)acetamide;hydrate |
|---|---|
| PubChem CID | 131860957 |
| Molecular Formula | C11H14Cl3NO3 |
| Molecular Weight | 314.60 g/mol |
| Exact Mass | 313.00 |
| IUPAC Name | N-propan-2-yl-2-(2,4,6-trichlorophenoxy)acetamide;hydrate |
| SMILES | CC(C)NC(=O)COc1c(Cl)cc(Cl)cc1Cl.O |
| InChI | InChI=1S/C11H12Cl3NO2.H2O/c1-6(2)15-10(16)5-17-11-8(13)3-7(12)4-9(11)14;/h3-4,6H,5H2,1-2H3,(H,15,16);1H2 |
| InChIKey | JNGABPNWOQJGPG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 69.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.60 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |