C15H22Cl2N2O2 — CID 60907916
2-[2-(2-aminobutyl)-4,6-dichlorophenoxy]-N-propan-2-ylacetamide (PubChem CID 60907916) has the molecular formula C15H22Cl2N2O2 and a molecular weight of 333.26 g/mol. Its IUPAC name is 2-[2-(2-aminobutyl)-4,6-dichlorophenoxy]-N-propan-2-ylacetamide.
| Compound Name | 2-[2-(2-aminobutyl)-4,6-dichlorophenoxy]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 60907916 |
| Molecular Formula | C15H22Cl2N2O2 |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 2-[2-(2-aminobutyl)-4,6-dichlorophenoxy]-N-propan-2-ylacetamide |
| SMILES | CCC(N)Cc1cc(Cl)cc(Cl)c1OCC(=O)NC(C)C |
| InChI | InChI=1S/C15H22Cl2N2O2/c1-4-12(18)6-10-5-11(16)7-13(17)15(10)21-8-14(20)19-9(2)3/h5,7,9,12H,4,6,8,18H2,1-3H3,(H,19,20) |
| InChIKey | DPJBRHMXMHBJAF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |