C13H15Cl2NO3 — CID 43516026
N-butan-2-yl-2-(2,4-dichloro-6-formylphenoxy)acetamide (PubChem CID 43516026) has the molecular formula C13H15Cl2NO3 and a molecular weight of 304.17 g/mol. Its IUPAC name is N-butan-2-yl-2-(2,4-dichloro-6-formylphenoxy)acetamide.
| Compound Name | N-butan-2-yl-2-(2,4-dichloro-6-formylphenoxy)acetamide |
|---|---|
| PubChem CID | 43516026 |
| Molecular Formula | C13H15Cl2NO3 |
| Molecular Weight | 304.17 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | N-butan-2-yl-2-(2,4-dichloro-6-formylphenoxy)acetamide |
| SMILES | CCC(C)NC(=O)COc1c(Cl)cc(Cl)cc1C=O |
| InChI | InChI=1S/C13H15Cl2NO3/c1-3-8(2)16-12(18)7-19-13-9(6-17)4-10(14)5-11(13)15/h4-6,8H,3,7H2,1-2H3,(H,16,18) |
| InChIKey | VDQMGRCVRXIKAJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.17 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|