C13H14Cl3NO4S — CID 54145321
2-propan-2-ylsulfanyl-2-[[2-(2,4,6-trichlorophenoxy)acetyl]amino]acetic acid (PubChem CID 54145321) has the molecular formula C13H14Cl3NO4S and a molecular weight of 386.68 g/mol. Its IUPAC name is 2-propan-2-ylsulfanyl-2-[[2-(2,4,6-trichlorophenoxy)acetyl]amino]acetic acid.
| Compound Name | 2-propan-2-ylsulfanyl-2-[[2-(2,4,6-trichlorophenoxy)acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 54145321 |
| Molecular Formula | C13H14Cl3NO4S |
| Molecular Weight | 386.68 g/mol |
| Exact Mass | 384.97 |
| IUPAC Name | 2-propan-2-ylsulfanyl-2-[[2-(2,4,6-trichlorophenoxy)acetyl]amino]acetic acid |
| SMILES | CC(C)SC(NC(=O)COc1c(Cl)cc(Cl)cc1Cl)C(=O)O |
| InChI | InChI=1S/C13H14Cl3NO4S/c1-6(2)22-12(13(19)20)17-10(18)5-21-11-8(15)3-7(14)4-9(11)16/h3-4,6,12H,5H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | ODYWQLHDYGNSEX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.68 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|